C13H22N2O5S — CID 107775508
(2R)-2-acetamido-3-[2-(azepan-1-yl)-2-oxoethyl]sulfinylpropanoic acid (PubChem CID 107775508) has the molecular formula C13H22N2O5S and a molecular weight of 318.39 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[2-(azepan-1-yl)-2-oxoethyl]sulfinylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[2-(azepan-1-yl)-2-oxoethyl]sulfinylpropanoic acid |
|---|---|
| PubChem CID | 107775508 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (2R)-2-acetamido-3-[2-(azepan-1-yl)-2-oxoethyl]sulfinylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CS(=O)CC(=O)N1CCCCCC1)C(=O)O |
| InChI | InChI=1S/C13H22N2O5S/c1-10(16)14-11(13(18)19)8-21(20)9-12(17)15-6-4-2-3-5-7-15/h11H,2-9H2,1H3,(H,14,16)(H,18,19)/t11-,21?/m0/s1 |
| InChIKey | RXDLIWUDAFONFL-QHIQZGGMSA-N |
| XLogP | -0.27 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |