C11H18N2O5S — CID 107775688
(2R)-2-acetamido-3-[2-(cyclopropylmethylamino)-2-oxoethyl]sulfinylpropanoic acid (PubChem CID 107775688) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[2-(cyclopropylmethylamino)-2-oxoethyl]sulfinylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[2-(cyclopropylmethylamino)-2-oxoethyl]sulfinylpropanoic acid |
|---|---|
| PubChem CID | 107775688 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (2R)-2-acetamido-3-[2-(cyclopropylmethylamino)-2-oxoethyl]sulfinylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CS(=O)CC(=O)NCC1CC1)C(=O)O |
| InChI | InChI=1S/C11H18N2O5S/c1-7(14)13-9(11(16)17)5-19(18)6-10(15)12-4-8-2-3-8/h8-9H,2-6H2,1H3,(H,12,15)(H,13,14)(H,16,17)/t9-,19?/m0/s1 |
| InChIKey | NGTPDJRRQMFETC-DUOAPZILSA-N |
| XLogP | -1.15 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |