C13H16BrNOS2 — CID 114000683
1-(4-bromothiophen-2-yl)-1-(2-methylfuran-3-yl)sulfanylbutan-2-amine (PubChem CID 114000683) has the molecular formula C13H16BrNOS2 and a molecular weight of 346.32 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-1-(2-methylfuran-3-yl)sulfanylbutan-2-amine.
| Compound Name | 1-(4-bromothiophen-2-yl)-1-(2-methylfuran-3-yl)sulfanylbutan-2-amine |
|---|---|
| PubChem CID | 114000683 |
| Molecular Formula | C13H16BrNOS2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-1-(2-methylfuran-3-yl)sulfanylbutan-2-amine |
| SMILES | CCC(N)C(Sc1ccoc1C)c1cc(Br)cs1 |
| InChI | InChI=1S/C13H16BrNOS2/c1-3-10(15)13(12-6-9(14)7-17-12)18-11-4-5-16-8(11)2/h4-7,10,13H,3,15H2,1-2H3 |
| InChIKey | NHPLMQJCWQXJAT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |