C13H7BrN4 — CID 114002030
4-[(5-bromo-3-pyridinyl)amino]benzene-1,2-dicarbonitrile (PubChem CID 114002030) has the molecular formula C13H7BrN4 and a molecular weight of 299.13 g/mol. Its IUPAC name is 4-[(5-bromo-3-pyridinyl)amino]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[(5-bromo-3-pyridinyl)amino]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 114002030 |
| Molecular Formula | C13H7BrN4 |
| Molecular Weight | 299.13 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 4-[(5-bromo-3-pyridinyl)amino]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Nc2cncc(Br)c2)cc1C#N |
| InChI | InChI=1S/C13H7BrN4/c14-11-4-13(8-17-7-11)18-12-2-1-9(5-15)10(3-12)6-16/h1-4,7-8,18H |
| InChIKey | QIYHVQCJVSHMJZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.13 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |