C13H6BrN5O2 — CID 107793116
4-[(5-bromo-3-nitro-2-pyridinyl)amino]benzene-1,2-dicarbonitrile (PubChem CID 107793116) has the molecular formula C13H6BrN5O2 and a molecular weight of 344.13 g/mol. Its IUPAC name is 4-[(5-bromo-3-nitro-2-pyridinyl)amino]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[(5-bromo-3-nitro-2-pyridinyl)amino]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107793116 |
| Molecular Formula | C13H6BrN5O2 |
| Molecular Weight | 344.13 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | 4-[(5-bromo-3-nitro-2-pyridinyl)amino]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Nc2ncc(Br)cc2[N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C13H6BrN5O2/c14-10-4-12(19(20)21)13(17-7-10)18-11-2-1-8(5-15)9(3-11)6-16/h1-4,7H,(H,17,18) |
| InChIKey | IPIGVMGKQISWQH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.13 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|