C15H14BrN3O2 — CID 63462010
5-bromo-3-nitro-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyridin-2-amine (PubChem CID 63462010) has the molecular formula C15H14BrN3O2 and a molecular weight of 348.20 g/mol. Its IUPAC name is 5-bromo-3-nitro-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyridin-2-amine.
| Compound Name | 5-bromo-3-nitro-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 63462010 |
| Molecular Formula | C15H14BrN3O2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 5-bromo-3-nitro-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C15H14BrN3O2/c16-11-8-14(19(20)21)15(17-9-11)18-13-7-3-5-10-4-1-2-6-12(10)13/h3,5,7-9H,1-2,4,6H2,(H,17,18) |
| InChIKey | JQQQLYJQKRLEOL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|