C10H19N3O4 — CID 114005249
(2R)-4-hydroxy-2-[(2-piperazin-1-ylacetyl)amino]butanoic acid (PubChem CID 114005249) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-[(2-piperazin-1-ylacetyl)amino]butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-[(2-piperazin-1-ylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 114005249 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (2R)-4-hydroxy-2-[(2-piperazin-1-ylacetyl)amino]butanoic acid |
| SMILES | O=C(CN1CCNCC1)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C10H19N3O4/c14-6-1-8(10(16)17)12-9(15)7-13-4-2-11-3-5-13/h8,11,14H,1-7H2,(H,12,15)(H,16,17)/t8-/m1/s1 |
| InChIKey | ARHIMIQKBTYOKN-MRVPVSSYSA-N |
| XLogP | -2.16 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |