C11H14N2O6 — CID 114006151
(2R)-2-[(5-methyl-1,2-oxazole-4-carbonyl)amino]hexanedioic acid (PubChem CID 114006151) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is (2R)-2-[(5-methyl-1,2-oxazole-4-carbonyl)amino]hexanedioic acid.
| Compound Name | (2R)-2-[(5-methyl-1,2-oxazole-4-carbonyl)amino]hexanedioic acid |
|---|---|
| PubChem CID | 114006151 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2R)-2-[(5-methyl-1,2-oxazole-4-carbonyl)amino]hexanedioic acid |
| SMILES | Cc1oncc1C(=O)N[C@H](CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H14N2O6/c1-6-7(5-12-19-6)10(16)13-8(11(17)18)3-2-4-9(14)15/h5,8H,2-4H2,1H3,(H,13,16)(H,14,15)(H,17,18)/t8-/m1/s1 |
| InChIKey | ICBYXWPBQLFMHV-MRVPVSSYSA-N |
| XLogP | 0.42 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |