C12H16N2O6 — CID 107831662
(2R)-2-[(2,4-dimethyl-1,3-oxazole-5-carbonyl)amino]hexanedioic acid (PubChem CID 107831662) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is (2R)-2-[(2,4-dimethyl-1,3-oxazole-5-carbonyl)amino]hexanedioic acid.
| Compound Name | (2R)-2-[(2,4-dimethyl-1,3-oxazole-5-carbonyl)amino]hexanedioic acid |
|---|---|
| PubChem CID | 107831662 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (2R)-2-[(2,4-dimethyl-1,3-oxazole-5-carbonyl)amino]hexanedioic acid |
| SMILES | Cc1nc(C)c(C(=O)N[C@H](CCCC(=O)O)C(=O)O)o1 |
| InChI | InChI=1S/C12H16N2O6/c1-6-10(20-7(2)13-6)11(17)14-8(12(18)19)4-3-5-9(15)16/h8H,3-5H2,1-2H3,(H,14,17)(H,15,16)(H,18,19)/t8-/m1/s1 |
| InChIKey | UWXMXJWLCYLGAM-MRVPVSSYSA-N |
| XLogP | 0.73 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |