C9H10N2O7 — CID 114006197
2-hydroxy-4-[(5-nitrofuran-2-carbonyl)amino]butanoic acid (PubChem CID 114006197) has the molecular formula C9H10N2O7 and a molecular weight of 258.19 g/mol. Its IUPAC name is 2-hydroxy-4-[(5-nitrofuran-2-carbonyl)amino]butanoic acid.
| Compound Name | 2-hydroxy-4-[(5-nitrofuran-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 114006197 |
| Molecular Formula | C9H10N2O7 |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-hydroxy-4-[(5-nitrofuran-2-carbonyl)amino]butanoic acid |
| SMILES | O=C(NCCC(O)C(=O)O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C9H10N2O7/c12-5(9(14)15)3-4-10-8(13)6-1-2-7(18-6)11(16)17/h1-2,5,12H,3-4H2,(H,10,13)(H,14,15) |
| InChIKey | YRUSBTBZWMUIBH-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|