C7H9N3O6S — CID 61129714
5-nitro-N-(2-sulfamoylethyl)furan-2-carboxamide (PubChem CID 61129714) has the molecular formula C7H9N3O6S and a molecular weight of 263.23 g/mol. Its IUPAC name is 5-nitro-N-(2-sulfamoylethyl)furan-2-carboxamide.
| Compound Name | 5-nitro-N-(2-sulfamoylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 61129714 |
| Molecular Formula | C7H9N3O6S |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 5-nitro-N-(2-sulfamoylethyl)furan-2-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C7H9N3O6S/c8-17(14,15)4-3-9-7(11)5-1-2-6(16-5)10(12)13/h1-2H,3-4H2,(H,9,11)(H2,8,14,15) |
| InChIKey | IVYXDVIHBCWFNG-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 145.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|