C16H27NO — CID 114013308
N-[(5-methyl-2-pentan-2-yloxyphenyl)methyl]propan-1-amine (PubChem CID 114013308) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is N-[(5-methyl-2-pentan-2-yloxyphenyl)methyl]propan-1-amine.
| Compound Name | N-[(5-methyl-2-pentan-2-yloxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114013308 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-[(5-methyl-2-pentan-2-yloxyphenyl)methyl]propan-1-amine |
| SMILES | CCCNCc1cc(C)ccc1OC(C)CCC |
| InChI | InChI=1S/C16H27NO/c1-5-7-14(4)18-16-9-8-13(3)11-15(16)12-17-10-6-2/h8-9,11,14,17H,5-7,10,12H2,1-4H3 |
| InChIKey | XYRPSGFDUHCCMN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|