C14H19NO — CID 63323347
N-[(5-methyl-2-prop-2-ynoxyphenyl)methyl]propan-1-amine (PubChem CID 63323347) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is N-[(5-methyl-2-prop-2-ynoxyphenyl)methyl]propan-1-amine.
| Compound Name | N-[(5-methyl-2-prop-2-ynoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 63323347 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-[(5-methyl-2-prop-2-ynoxyphenyl)methyl]propan-1-amine |
| SMILES | C#CCOc1ccc(C)cc1CNCCC |
| InChI | InChI=1S/C14H19NO/c1-4-8-15-11-13-10-12(3)6-7-14(13)16-9-5-2/h2,6-7,10,15H,4,8-9,11H2,1,3H3 |
| InChIKey | MROHCCYUJOKVND-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|