C13H17NO — CID 63326075
1-(5-methyl-2-prop-2-ynoxyphenyl)propan-2-amine (PubChem CID 63326075) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-(5-methyl-2-prop-2-ynoxyphenyl)propan-2-amine.
| Compound Name | 1-(5-methyl-2-prop-2-ynoxyphenyl)propan-2-amine |
|---|---|
| PubChem CID | 63326075 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-(5-methyl-2-prop-2-ynoxyphenyl)propan-2-amine |
| SMILES | C#CCOc1ccc(C)cc1CC(C)N |
| InChI | InChI=1S/C13H17NO/c1-4-7-15-13-6-5-10(2)8-12(13)9-11(3)14/h1,5-6,8,11H,7,9,14H2,2-3H3 |
| InChIKey | XBWYUBOEMXAVAO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|