C13H16FNOS — CID 114013651
2-fluoro-5-(3-methylbutylsulfinylmethyl)benzonitrile (PubChem CID 114013651) has the molecular formula C13H16FNOS and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-fluoro-5-(3-methylbutylsulfinylmethyl)benzonitrile.
| Compound Name | 2-fluoro-5-(3-methylbutylsulfinylmethyl)benzonitrile |
|---|---|
| PubChem CID | 114013651 |
| Molecular Formula | C13H16FNOS |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-fluoro-5-(3-methylbutylsulfinylmethyl)benzonitrile |
| SMILES | CC(C)CCS(=O)Cc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C13H16FNOS/c1-10(2)5-6-17(16)9-11-3-4-13(14)12(7-11)8-15/h3-4,7,10H,5-6,9H2,1-2H3 |
| InChIKey | CWANQRKZTAYHKO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |