C15H24FN — CID 114013785
2-(4-fluorophenyl)-2,4-dimethylheptan-3-amine (PubChem CID 114013785) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2,4-dimethylheptan-3-amine.
| Compound Name | 2-(4-fluorophenyl)-2,4-dimethylheptan-3-amine |
|---|---|
| PubChem CID | 114013785 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | 2-(4-fluorophenyl)-2,4-dimethylheptan-3-amine |
| SMILES | CCCC(C)C(N)C(C)(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H24FN/c1-5-6-11(2)14(17)15(3,4)12-7-9-13(16)10-8-12/h7-11,14H,5-6,17H2,1-4H3 |
| InChIKey | BKQBWZFYJLQUSZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |