C16H25FO — CID 64768744
2-(4-fluorophenyl)-2,6,6-trimethylheptan-3-ol (PubChem CID 64768744) has the molecular formula C16H25FO and a molecular weight of 252.37 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2,6,6-trimethylheptan-3-ol.
| Compound Name | 2-(4-fluorophenyl)-2,6,6-trimethylheptan-3-ol |
|---|---|
| PubChem CID | 64768744 |
| Molecular Formula | C16H25FO |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 2-(4-fluorophenyl)-2,6,6-trimethylheptan-3-ol |
| SMILES | CC(C)(C)CCC(O)C(C)(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H25FO/c1-15(2,3)11-10-14(18)16(4,5)12-6-8-13(17)9-7-12/h6-9,14,18H,10-11H2,1-5H3 |
| InChIKey | FXXDNJRZYAQQEC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |