C14H18F4O — CID 115516102
7,7,7-trifluoro-2-(4-fluorophenyl)-2-methylheptan-3-ol (PubChem CID 115516102) has the molecular formula C14H18F4O and a molecular weight of 278.29 g/mol. Its IUPAC name is 7,7,7-trifluoro-2-(4-fluorophenyl)-2-methylheptan-3-ol.
| Compound Name | 7,7,7-trifluoro-2-(4-fluorophenyl)-2-methylheptan-3-ol |
|---|---|
| PubChem CID | 115516102 |
| Molecular Formula | C14H18F4O |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 7,7,7-trifluoro-2-(4-fluorophenyl)-2-methylheptan-3-ol |
| SMILES | CC(C)(c1ccc(F)cc1)C(O)CCCC(F)(F)F |
| InChI | InChI=1S/C14H18F4O/c1-13(2,10-5-7-11(15)8-6-10)12(19)4-3-9-14(16,17)18/h5-8,12,19H,3-4,9H2,1-2H3 |
| InChIKey | FXCVFCRAFNNJAY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |