C14H17FO — CID 64769916
2-(4-fluorophenyl)-2-methylhept-6-yn-3-ol (PubChem CID 64769916) has the molecular formula C14H17FO and a molecular weight of 220.29 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-methylhept-6-yn-3-ol.
| Compound Name | 2-(4-fluorophenyl)-2-methylhept-6-yn-3-ol |
|---|---|
| PubChem CID | 64769916 |
| Molecular Formula | C14H17FO |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-(4-fluorophenyl)-2-methylhept-6-yn-3-ol |
| SMILES | C#CCCC(O)C(C)(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H17FO/c1-4-5-6-13(16)14(2,3)11-7-9-12(15)10-8-11/h1,7-10,13,16H,5-6H2,2-3H3 |
| InChIKey | KKVOLHLDCFOJST-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|