C16H32N2 — CID 114013955
1-[(E)-but-2-enyl]-5,5-diethyl-2-(2-methylpropyl)piperazine (PubChem CID 114013955) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-5,5-diethyl-2-(2-methylpropyl)piperazine.
| Compound Name | 1-[(E)-but-2-enyl]-5,5-diethyl-2-(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 114013955 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 1-[(E)-but-2-enyl]-5,5-diethyl-2-(2-methylpropyl)piperazine |
| SMILES | C/C=C/CN1CC(CC)(CC)NCC1CC(C)C |
| InChI | InChI=1S/C16H32N2/c1-6-9-10-18-13-16(7-2,8-3)17-12-15(18)11-14(4)5/h6,9,14-15,17H,7-8,10-13H2,1-5H3/b9-6+ |
| InChIKey | VEJOFAUBJWVSIU-RMKNXTFCSA-N |
| XLogP | 3.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|