C15H29ClN2 — CID 107901805
2-butan-2-yl-1-[(E)-3-chloroprop-2-enyl]-5,5-diethylpiperazine (PubChem CID 107901805) has the molecular formula C15H29ClN2 and a molecular weight of 272.86 g/mol. Its IUPAC name is 2-butan-2-yl-1-[(E)-3-chloroprop-2-enyl]-5,5-diethylpiperazine.
| Compound Name | 2-butan-2-yl-1-[(E)-3-chloroprop-2-enyl]-5,5-diethylpiperazine |
|---|---|
| PubChem CID | 107901805 |
| Molecular Formula | C15H29ClN2 |
| Molecular Weight | 272.86 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 2-butan-2-yl-1-[(E)-3-chloroprop-2-enyl]-5,5-diethylpiperazine |
| SMILES | CCC(C)C1CNC(CC)(CC)CN1C/C=C/Cl |
| InChI | InChI=1S/C15H29ClN2/c1-5-13(4)14-11-17-15(6-2,7-3)12-18(14)10-8-9-16/h8-9,13-14,17H,5-7,10-12H2,1-4H3/b9-8+ |
| InChIKey | BITKVGQIJKATKI-CMDGGOBGSA-N |
| XLogP | 3.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.86 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |