C13H17BrN2O2 — CID 114014417
4-[[2-bromopropanoyl(methyl)amino]methyl]-N-methylbenzamide (PubChem CID 114014417) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.20 g/mol. Its IUPAC name is 4-[[2-bromopropanoyl(methyl)amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[2-bromopropanoyl(methyl)amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 114014417 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 4-[[2-bromopropanoyl(methyl)amino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CN(C)C(=O)C(C)Br)cc1 |
| InChI | InChI=1S/C13H17BrN2O2/c1-9(14)13(18)16(3)8-10-4-6-11(7-5-10)12(17)15-2/h4-7,9H,8H2,1-3H3,(H,15,17) |
| InChIKey | NEGYIMDHGLZSOJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|