C14H18N2O4 — CID 60699252
4-[methyl-[[4-(methylcarbamoyl)phenyl]methyl]amino]-4-oxobutanoic acid (PubChem CID 60699252) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-[methyl-[[4-(methylcarbamoyl)phenyl]methyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[methyl-[[4-(methylcarbamoyl)phenyl]methyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 60699252 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-[methyl-[[4-(methylcarbamoyl)phenyl]methyl]amino]-4-oxobutanoic acid |
| SMILES | CNC(=O)c1ccc(CN(C)C(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C14H18N2O4/c1-15-14(20)11-5-3-10(4-6-11)9-16(2)12(17)7-8-13(18)19/h3-6H,7-9H2,1-2H3,(H,15,20)(H,18,19) |
| InChIKey | ROSUZWPTFGZZKB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |