C12H15FN2O2S — CID 114014876
2-(2-aminobutylsulfonylmethyl)-4-fluorobenzonitrile (PubChem CID 114014876) has the molecular formula C12H15FN2O2S and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(2-aminobutylsulfonylmethyl)-4-fluorobenzonitrile.
| Compound Name | 2-(2-aminobutylsulfonylmethyl)-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 114014876 |
| Molecular Formula | C12H15FN2O2S |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-(2-aminobutylsulfonylmethyl)-4-fluorobenzonitrile |
| SMILES | CCC(N)CS(=O)(=O)Cc1cc(F)ccc1C#N |
| InChI | InChI=1S/C12H15FN2O2S/c1-2-12(15)8-18(16,17)7-10-5-11(13)4-3-9(10)6-14/h3-5,12H,2,7-8,15H2,1H3 |
| InChIKey | WCYDAMHMHIXQRB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |