C13H11Cl3N2 — CID 114015741
5-(1-chloroethyl)-2-(3,5-dichlorophenyl)-4-methylpyrimidine (PubChem CID 114015741) has the molecular formula C13H11Cl3N2 and a molecular weight of 301.60 g/mol. Its IUPAC name is 5-(1-chloroethyl)-2-(3,5-dichlorophenyl)-4-methylpyrimidine.
| Compound Name | 5-(1-chloroethyl)-2-(3,5-dichlorophenyl)-4-methylpyrimidine |
|---|---|
| PubChem CID | 114015741 |
| Molecular Formula | C13H11Cl3N2 |
| Molecular Weight | 301.60 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 5-(1-chloroethyl)-2-(3,5-dichlorophenyl)-4-methylpyrimidine |
| SMILES | Cc1nc(-c2cc(Cl)cc(Cl)c2)ncc1C(C)Cl |
| InChI | InChI=1S/C13H11Cl3N2/c1-7(14)12-6-17-13(18-8(12)2)9-3-10(15)5-11(16)4-9/h3-7H,1-2H3 |
| InChIKey | QPUPGLAVKWBDOC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|