C13H12F3N3 — CID 103431927
(1S)-1-[4-methyl-2-(3,4,5-trifluorophenyl)pyrimidin-5-yl]ethanamine (PubChem CID 103431927) has the molecular formula C13H12F3N3 and a molecular weight of 267.25 g/mol. Its IUPAC name is (1S)-1-[4-methyl-2-(3,4,5-trifluorophenyl)pyrimidin-5-yl]ethanamine.
| Compound Name | (1S)-1-[4-methyl-2-(3,4,5-trifluorophenyl)pyrimidin-5-yl]ethanamine |
|---|---|
| PubChem CID | 103431927 |
| Molecular Formula | C13H12F3N3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (1S)-1-[4-methyl-2-(3,4,5-trifluorophenyl)pyrimidin-5-yl]ethanamine |
| SMILES | Cc1nc(-c2cc(F)c(F)c(F)c2)ncc1[C@H](C)N |
| InChI | InChI=1S/C13H12F3N3/c1-6(17)9-5-18-13(19-7(9)2)8-3-10(14)12(16)11(15)4-8/h3-6H,17H2,1-2H3/t6-/m0/s1 |
| InChIKey | XSGYKTDEBUGLLU-LURJTMIESA-N |
| XLogP | 2.89 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|