C12H8BrF3N2 — CID 114245098
4-(bromomethyl)-5-methyl-2-(3,4,5-trifluorophenyl)pyrimidine (PubChem CID 114245098) has the molecular formula C12H8BrF3N2 and a molecular weight of 317.11 g/mol. Its IUPAC name is 4-(bromomethyl)-5-methyl-2-(3,4,5-trifluorophenyl)pyrimidine.
| Compound Name | 4-(bromomethyl)-5-methyl-2-(3,4,5-trifluorophenyl)pyrimidine |
|---|---|
| PubChem CID | 114245098 |
| Molecular Formula | C12H8BrF3N2 |
| Molecular Weight | 317.11 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 4-(bromomethyl)-5-methyl-2-(3,4,5-trifluorophenyl)pyrimidine |
| SMILES | Cc1cnc(-c2cc(F)c(F)c(F)c2)nc1CBr |
| InChI | InChI=1S/C12H8BrF3N2/c1-6-5-17-12(18-10(6)4-13)7-2-8(14)11(16)9(15)3-7/h2-3,5H,4H2,1H3 |
| InChIKey | LZYOBBMPBXWWPM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.11 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|