C14H9Cl2NS — CID 114017358
2-(3,4-dichlorophenyl)sulfanyl-5-methylbenzonitrile (PubChem CID 114017358) has the molecular formula C14H9Cl2NS and a molecular weight of 294.21 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)sulfanyl-5-methylbenzonitrile.
| Compound Name | 2-(3,4-dichlorophenyl)sulfanyl-5-methylbenzonitrile |
|---|---|
| PubChem CID | 114017358 |
| Molecular Formula | C14H9Cl2NS |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 2-(3,4-dichlorophenyl)sulfanyl-5-methylbenzonitrile |
| SMILES | Cc1ccc(Sc2ccc(Cl)c(Cl)c2)c(C#N)c1 |
| InChI | InChI=1S/C14H9Cl2NS/c1-9-2-5-14(10(6-9)8-17)18-11-3-4-12(15)13(16)7-11/h2-7H,1H3 |
| InChIKey | WNODETLTHIZYGY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |