About (2-cyano-4-methylphenyl) thiocyanate
(2-cyano-4-methylphenyl) thiocyanate (PubChem CID 142372966) has the molecular formula C9H6N2S
and a molecular weight of 174.23 g/mol. Its IUPAC name is (2-cyano-4-methylphenyl) thiocyanate.
Molecular Properties
| Compound Name | (2-cyano-4-methylphenyl) thiocyanate |
| PubChem CID | 142372966 |
| Molecular Formula | C9H6N2S |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | (2-cyano-4-methylphenyl) thiocyanate |
| SMILES | Cc1ccc(SC#N)c(C#N)c1 |
| InChI | InChI=1S/C9H6N2S/c1-7-2-3-9(12-6-11)8(4-7)5-10/h2-4H,1H3 |
| InChIKey | CJIXTQZVBLIWOA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2-cyano-4-methylphenyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyano-4-methylphenyl) thiocyanate?
The IUPAC name of (2-cyano-4-methylphenyl) thiocyanate (CID 142372966) is (2-cyano-4-methylphenyl) thiocyanate.
What is the SMILES notation for (2-cyano-4-methylphenyl) thiocyanate?
The canonical SMILES for (2-cyano-4-methylphenyl) thiocyanate is Cc1ccc(SC#N)c(C#N)c1.
What is the InChIKey of (2-cyano-4-methylphenyl) thiocyanate?
The InChIKey is CJIXTQZVBLIWOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2S/c1-7-2-3-9(12-6-11)8(4-7)5-10/h2-4H,1H3.
What are the key properties of (2-cyano-4-methylphenyl) thiocyanate?
(2-cyano-4-methylphenyl) thiocyanate has a molecular weight of 174.23 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyano-4-methylphenyl) thiocyanate is sourced from PubChem (CID 142372966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).