C12H12F2N2O — CID 114017704
2,3-difluoro-4-(oxolan-3-ylmethylamino)benzonitrile (PubChem CID 114017704) has the molecular formula C12H12F2N2O and a molecular weight of 238.24 g/mol. Its IUPAC name is 2,3-difluoro-4-(oxolan-3-ylmethylamino)benzonitrile.
| Compound Name | 2,3-difluoro-4-(oxolan-3-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 114017704 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2,3-difluoro-4-(oxolan-3-ylmethylamino)benzonitrile |
| SMILES | N#Cc1ccc(NCC2CCOC2)c(F)c1F |
| InChI | InChI=1S/C12H12F2N2O/c13-11-9(5-15)1-2-10(12(11)14)16-6-8-3-4-17-7-8/h1-2,8,16H,3-4,6-7H2 |
| InChIKey | UMLDMGGDADMWBP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |