About 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile
4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile (PubChem CID 107934013) has the molecular formula C12H12F2N2O2S
and a molecular weight of 286.30 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile |
| PubChem CID | 107934013 |
| Molecular Formula | C12H12F2N2O2S |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile |
| SMILES | N#Cc1ccc(NCC2CCCS2(=O)=O)c(F)c1F |
| InChI | InChI=1S/C12H12F2N2O2S/c13-11-8(6-15)3-4-10(12(11)14)16-7-9-2-1-5-19(9,17)18/h3-4,9,16H,1-2,5,7H2 |
| InChIKey | HJKSIHGVJPVWHG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile?
The IUPAC name of 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile (CID 107934013) is 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile.
What is the SMILES notation for 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile?
The canonical SMILES for 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile is N#Cc1ccc(NCC2CCCS2(=O)=O)c(F)c1F.
What is the InChIKey of 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile?
The InChIKey is HJKSIHGVJPVWHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2N2O2S/c13-11-8(6-15)3-4-10(12(11)14)16-7-9-2-1-5-19(9,17)18/h3-4,9,16H,1-2,5,7H2.
What are the key properties of 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile?
4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile has a molecular weight of 286.30 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile is sourced from PubChem (CID 107934013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).