C12H12F2N2O2S — CID 107934013
4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile (PubChem CID 107934013) has the molecular formula C12H12F2N2O2S and a molecular weight of 286.30 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile.
| Compound Name | 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 107934013 |
| Molecular Formula | C12H12F2N2O2S |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 4-[(1,1-dioxothiolan-2-yl)methylamino]-2,3-difluorobenzonitrile |
| SMILES | N#Cc1ccc(NCC2CCCS2(=O)=O)c(F)c1F |
| InChI | InChI=1S/C12H12F2N2O2S/c13-11-8(6-15)3-4-10(12(11)14)16-7-9-2-1-5-19(9,17)18/h3-4,9,16H,1-2,5,7H2 |
| InChIKey | HJKSIHGVJPVWHG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |