C12H13ClN2O2S — CID 81039334
4-chloro-2-[(1,1-dioxothiolan-2-yl)methylamino]benzonitrile (PubChem CID 81039334) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is 4-chloro-2-[(1,1-dioxothiolan-2-yl)methylamino]benzonitrile.
| Compound Name | 4-chloro-2-[(1,1-dioxothiolan-2-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 81039334 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 4-chloro-2-[(1,1-dioxothiolan-2-yl)methylamino]benzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1NCC1CCCS1(=O)=O |
| InChI | InChI=1S/C12H13ClN2O2S/c13-10-4-3-9(7-14)12(6-10)15-8-11-2-1-5-18(11,16)17/h3-4,6,11,15H,1-2,5,8H2 |
| InChIKey | NPJWWQUZRVYTQR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |