C12H13FN2O2S — CID 81038557
2-[(1,1-dioxothiolan-2-yl)methylamino]-5-fluorobenzonitrile (PubChem CID 81038557) has the molecular formula C12H13FN2O2S and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-2-yl)methylamino]-5-fluorobenzonitrile.
| Compound Name | 2-[(1,1-dioxothiolan-2-yl)methylamino]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 81038557 |
| Molecular Formula | C12H13FN2O2S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-[(1,1-dioxothiolan-2-yl)methylamino]-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)ccc1NCC1CCCS1(=O)=O |
| InChI | InChI=1S/C12H13FN2O2S/c13-10-3-4-12(9(6-10)7-14)15-8-11-2-1-5-18(11,16)17/h3-4,6,11,15H,1-2,5,8H2 |
| InChIKey | WHMLPLRGEDRDBF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |