C11H16N2O4S — CID 114018222
2-[1-[(2-propoxyacetyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 114018222) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-[1-[(2-propoxyacetyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[1-[(2-propoxyacetyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114018222 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-[1-[(2-propoxyacetyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCOCC(=O)NC(C)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C11H16N2O4S/c1-3-4-17-5-9(14)12-7(2)10-13-8(6-18-10)11(15)16/h6-7H,3-5H2,1-2H3,(H,12,14)(H,15,16) |
| InChIKey | OTZCWYAIBSYWHX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|