C12H13Br2N3O — CID 114019485
(2,4-dibromophenyl)-(3-propyltriazol-4-yl)methanol (PubChem CID 114019485) has the molecular formula C12H13Br2N3O and a molecular weight of 375.06 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(3-propyltriazol-4-yl)methanol.
| Compound Name | (2,4-dibromophenyl)-(3-propyltriazol-4-yl)methanol |
|---|---|
| PubChem CID | 114019485 |
| Molecular Formula | C12H13Br2N3O |
| Molecular Weight | 375.06 g/mol |
| Exact Mass | 372.94 |
| IUPAC Name | (2,4-dibromophenyl)-(3-propyltriazol-4-yl)methanol |
| SMILES | CCCn1nncc1C(O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H13Br2N3O/c1-2-5-17-11(7-15-16-17)12(18)9-4-3-8(13)6-10(9)14/h3-4,6-7,12,18H,2,5H2,1H3 |
| InChIKey | BWEFPOUARDIICX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.06 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |