C12H13BrFN3O — CID 115834049
(2-bromo-3-fluorophenyl)-(3-propyltriazol-4-yl)methanol (PubChem CID 115834049) has the molecular formula C12H13BrFN3O and a molecular weight of 314.16 g/mol. Its IUPAC name is (2-bromo-3-fluorophenyl)-(3-propyltriazol-4-yl)methanol.
| Compound Name | (2-bromo-3-fluorophenyl)-(3-propyltriazol-4-yl)methanol |
|---|---|
| PubChem CID | 115834049 |
| Molecular Formula | C12H13BrFN3O |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | (2-bromo-3-fluorophenyl)-(3-propyltriazol-4-yl)methanol |
| SMILES | CCCn1nncc1C(O)c1cccc(F)c1Br |
| InChI | InChI=1S/C12H13BrFN3O/c1-2-6-17-10(7-15-16-17)12(18)8-4-3-5-9(14)11(8)13/h3-5,7,12,18H,2,6H2,1H3 |
| InChIKey | SQCIIMWXYIRIDA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |