C13H16FN3O2 — CID 114685101
(3-fluoro-4-methoxyphenyl)-(3-propyltriazol-4-yl)methanol (PubChem CID 114685101) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)-(3-propyltriazol-4-yl)methanol.
| Compound Name | (3-fluoro-4-methoxyphenyl)-(3-propyltriazol-4-yl)methanol |
|---|---|
| PubChem CID | 114685101 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)-(3-propyltriazol-4-yl)methanol |
| SMILES | CCCn1nncc1C(O)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C13H16FN3O2/c1-3-6-17-11(8-15-16-17)13(18)9-4-5-12(19-2)10(14)7-9/h4-5,7-8,13,18H,3,6H2,1-2H3 |
| InChIKey | RJUZPLURYSXMHZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |