C14H17N3O4 — CID 114685479
(7-methoxy-1,3-benzodioxol-5-yl)-(3-propyltriazol-4-yl)methanol (PubChem CID 114685479) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is (7-methoxy-1,3-benzodioxol-5-yl)-(3-propyltriazol-4-yl)methanol.
| Compound Name | (7-methoxy-1,3-benzodioxol-5-yl)-(3-propyltriazol-4-yl)methanol |
|---|---|
| PubChem CID | 114685479 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (7-methoxy-1,3-benzodioxol-5-yl)-(3-propyltriazol-4-yl)methanol |
| SMILES | CCCn1nncc1C(O)c1cc(OC)c2c(c1)OCO2 |
| InChI | InChI=1S/C14H17N3O4/c1-3-4-17-10(7-15-16-17)13(18)9-5-11(19-2)14-12(6-9)20-8-21-14/h5-7,13,18H,3-4,8H2,1-2H3 |
| InChIKey | RSZAPKIJWGARHV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |