About ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate
ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate (PubChem CID 11401975) has the molecular formula C11H18O3S
and a molecular weight of 230.33 g/mol. Its IUPAC name is ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate |
| PubChem CID | 11401975 |
| Molecular Formula | C11H18O3S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)CCC(OCC)S1 |
| InChI | InChI=1S/C11H18O3S/c1-4-13-9-7-6-8(3)10(15-9)11(12)14-5-2/h9H,4-7H2,1-3H3 |
| InChIKey | ZRWXZBLLSHOAGS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate?
The IUPAC name of ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate (CID 11401975) is ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate.
What is the SMILES notation for ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate?
The canonical SMILES for ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate is CCOC(=O)C1=C(C)CCC(OCC)S1.
What is the InChIKey of ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate?
The InChIKey is ZRWXZBLLSHOAGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3S/c1-4-13-9-7-6-8(3)10(15-9)11(12)14-5-2/h9H,4-7H2,1-3H3.
What are the key properties of ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate?
ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate has a molecular weight of 230.33 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-ethoxy-5-methyl-3,4-dihydro-2H-thiopyran-6-carboxylate is sourced from PubChem (CID 11401975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).