C13H20O2S — CID 134988575
3-methylbut-2-enyl 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carboxylate (PubChem CID 134988575) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 3-methylbut-2-enyl 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carboxylate.
| Compound Name | 3-methylbut-2-enyl 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carboxylate |
|---|---|
| PubChem CID | 134988575 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 3-methylbut-2-enyl 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carboxylate |
| SMILES | CC(C)=CCOC(=O)C1CC(C)=C(C)CS1 |
| InChI | InChI=1S/C13H20O2S/c1-9(2)5-6-15-13(14)12-7-10(3)11(4)8-16-12/h5,12H,6-8H2,1-4H3 |
| InChIKey | MOXZJCVTKKDIFF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|