C13H7BrCl2N2S — CID 114021117
2-(5-bromothiophen-3-yl)-4,5-dichloro-8-methylquinazoline (PubChem CID 114021117) has the molecular formula C13H7BrCl2N2S and a molecular weight of 374.09 g/mol. Its IUPAC name is 2-(5-bromothiophen-3-yl)-4,5-dichloro-8-methylquinazoline.
| Compound Name | 2-(5-bromothiophen-3-yl)-4,5-dichloro-8-methylquinazoline |
|---|---|
| PubChem CID | 114021117 |
| Molecular Formula | C13H7BrCl2N2S |
| Molecular Weight | 374.09 g/mol |
| Exact Mass | 371.89 |
| IUPAC Name | 2-(5-bromothiophen-3-yl)-4,5-dichloro-8-methylquinazoline |
| SMILES | Cc1ccc(Cl)c2c(Cl)nc(-c3csc(Br)c3)nc12 |
| InChI | InChI=1S/C13H7BrCl2N2S/c1-6-2-3-8(15)10-11(6)17-13(18-12(10)16)7-4-9(14)19-5-7/h2-5H,1H3 |
| InChIKey | JBGHMMRWQCCSLR-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.09 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |