C21H17ClFN3O — CID 1140213
(2S)-3-(2-chloro-5,8-dimethylquinolin-3-yl)-2-cyano-N-(4-fluorophenyl)propanamide (PubChem CID 1140213) has the molecular formula C21H17ClFN3O and a molecular weight of 381.84 g/mol. Its IUPAC name is (2S)-3-(2-chloro-5,8-dimethylquinolin-3-yl)-2-cyano-N-(4-fluorophenyl)propanamide.
| Compound Name | (2S)-3-(2-chloro-5,8-dimethylquinolin-3-yl)-2-cyano-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 1140213 |
| Molecular Formula | C21H17ClFN3O |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (2S)-3-(2-chloro-5,8-dimethylquinolin-3-yl)-2-cyano-N-(4-fluorophenyl)propanamide |
| SMILES | Cc1ccc(C)c2nc(Cl)c(C[C@@H](C#N)C(=O)Nc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C21H17ClFN3O/c1-12-3-4-13(2)19-18(12)10-14(20(22)26-19)9-15(11-24)21(27)25-17-7-5-16(23)6-8-17/h3-8,10,15H,9H2,1-2H3,(H,25,27)/t15-/m0/s1 |
| InChIKey | OCNVHMLDALYJJK-HNNXBMFYSA-N |
| XLogP | 4.97 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|