C12H16BrN3OS — CID 114021771
3-[5-(5-bromothiophen-3-yl)-1,3,4-oxadiazol-2-yl]-N-propan-2-ylpropan-1-amine (PubChem CID 114021771) has the molecular formula C12H16BrN3OS and a molecular weight of 330.25 g/mol. Its IUPAC name is 3-[5-(5-bromothiophen-3-yl)-1,3,4-oxadiazol-2-yl]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-[5-(5-bromothiophen-3-yl)-1,3,4-oxadiazol-2-yl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 114021771 |
| Molecular Formula | C12H16BrN3OS |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 3-[5-(5-bromothiophen-3-yl)-1,3,4-oxadiazol-2-yl]-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)NCCCc1nnc(-c2csc(Br)c2)o1 |
| InChI | InChI=1S/C12H16BrN3OS/c1-8(2)14-5-3-4-11-15-16-12(17-11)9-6-10(13)18-7-9/h6-8,14H,3-5H2,1-2H3 |
| InChIKey | PEJSZVXDGZTDIB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|