C12H16ClN3OS — CID 62278623
3-[5-(5-chlorothiophen-2-yl)-1,3,4-oxadiazol-2-yl]-N-propan-2-ylpropan-1-amine (PubChem CID 62278623) has the molecular formula C12H16ClN3OS and a molecular weight of 285.80 g/mol. Its IUPAC name is 3-[5-(5-chlorothiophen-2-yl)-1,3,4-oxadiazol-2-yl]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-[5-(5-chlorothiophen-2-yl)-1,3,4-oxadiazol-2-yl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 62278623 |
| Molecular Formula | C12H16ClN3OS |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 3-[5-(5-chlorothiophen-2-yl)-1,3,4-oxadiazol-2-yl]-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)NCCCc1nnc(-c2ccc(Cl)s2)o1 |
| InChI | InChI=1S/C12H16ClN3OS/c1-8(2)14-7-3-4-11-15-16-12(17-11)9-5-6-10(13)18-9/h5-6,8,14H,3-4,7H2,1-2H3 |
| InChIKey | QIPHPFFZRPVINT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|