C14H21N3O2 — CID 79084387
3-[5-(5-ethylfuran-2-yl)-1,3,4-oxadiazol-2-yl]-N-propan-2-ylpropan-1-amine (PubChem CID 79084387) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-[5-(5-ethylfuran-2-yl)-1,3,4-oxadiazol-2-yl]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-[5-(5-ethylfuran-2-yl)-1,3,4-oxadiazol-2-yl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 79084387 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 3-[5-(5-ethylfuran-2-yl)-1,3,4-oxadiazol-2-yl]-N-propan-2-ylpropan-1-amine |
| SMILES | CCc1ccc(-c2nnc(CCCNC(C)C)o2)o1 |
| InChI | InChI=1S/C14H21N3O2/c1-4-11-7-8-12(18-11)14-17-16-13(19-14)6-5-9-15-10(2)3/h7-8,10,15H,4-6,9H2,1-3H3 |
| InChIKey | PKINYJGOYNYNRY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|