C12H10BrCl2N3 — CID 114025481
3-(2-bromo-4-chlorophenyl)-5-(chloromethyl)-4-cyclopropyl-1,2,4-triazole (PubChem CID 114025481) has the molecular formula C12H10BrCl2N3 and a molecular weight of 347.04 g/mol. Its IUPAC name is 3-(2-bromo-4-chlorophenyl)-5-(chloromethyl)-4-cyclopropyl-1,2,4-triazole.
| Compound Name | 3-(2-bromo-4-chlorophenyl)-5-(chloromethyl)-4-cyclopropyl-1,2,4-triazole |
|---|---|
| PubChem CID | 114025481 |
| Molecular Formula | C12H10BrCl2N3 |
| Molecular Weight | 347.04 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | 3-(2-bromo-4-chlorophenyl)-5-(chloromethyl)-4-cyclopropyl-1,2,4-triazole |
| SMILES | ClCc1nnc(-c2ccc(Cl)cc2Br)n1C1CC1 |
| InChI | InChI=1S/C12H10BrCl2N3/c13-10-5-7(15)1-4-9(10)12-17-16-11(6-14)18(12)8-2-3-8/h1,4-5,8H,2-3,6H2 |
| InChIKey | LHPVZXAYCVLBMX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.04 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|