C12H10Cl3N3 — CID 115397763
3-(chloromethyl)-4-cyclopropyl-5-(3,5-dichlorophenyl)-1,2,4-triazole (PubChem CID 115397763) has the molecular formula C12H10Cl3N3 and a molecular weight of 302.59 g/mol. Its IUPAC name is 3-(chloromethyl)-4-cyclopropyl-5-(3,5-dichlorophenyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-cyclopropyl-5-(3,5-dichlorophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115397763 |
| Molecular Formula | C12H10Cl3N3 |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 3-(chloromethyl)-4-cyclopropyl-5-(3,5-dichlorophenyl)-1,2,4-triazole |
| SMILES | ClCc1nnc(-c2cc(Cl)cc(Cl)c2)n1C1CC1 |
| InChI | InChI=1S/C12H10Cl3N3/c13-6-11-16-17-12(18(11)10-1-2-10)7-3-8(14)5-9(15)4-7/h3-5,10H,1-2,6H2 |
| InChIKey | PKFBSNVFYLFYKT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|