C13H18BrIN2O — CID 114026176
N-[3-(aminomethyl)pentan-3-yl]-2-bromo-5-iodobenzamide (PubChem CID 114026176) has the molecular formula C13H18BrIN2O and a molecular weight of 425.11 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-2-bromo-5-iodobenzamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-2-bromo-5-iodobenzamide |
|---|---|
| PubChem CID | 114026176 |
| Molecular Formula | C13H18BrIN2O |
| Molecular Weight | 425.11 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-2-bromo-5-iodobenzamide |
| SMILES | CCC(CC)(CN)NC(=O)c1cc(I)ccc1Br |
| InChI | InChI=1S/C13H18BrIN2O/c1-3-13(4-2,8-16)17-12(18)10-7-9(15)5-6-11(10)14/h5-7H,3-4,8,16H2,1-2H3,(H,17,18) |
| InChIKey | MSCAANOOGJBIHV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.11 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|