C16H12BrIO — CID 114026848
2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(2-bromo-5-iodophenyl)ethanone (PubChem CID 114026848) has the molecular formula C16H12BrIO and a molecular weight of 427.08 g/mol. Its IUPAC name is 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(2-bromo-5-iodophenyl)ethanone.
| Compound Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(2-bromo-5-iodophenyl)ethanone |
|---|---|
| PubChem CID | 114026848 |
| Molecular Formula | C16H12BrIO |
| Molecular Weight | 427.08 g/mol |
| Exact Mass | 425.91 |
| IUPAC Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(2-bromo-5-iodophenyl)ethanone |
| SMILES | O=C(CC1Cc2ccccc21)c1cc(I)ccc1Br |
| InChI | InChI=1S/C16H12BrIO/c17-15-6-5-12(18)9-14(15)16(19)8-11-7-10-3-1-2-4-13(10)11/h1-6,9,11H,7-8H2 |
| InChIKey | AKVVLWPDPPYPEY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.08 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|