About [(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate
[(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate (PubChem CID 11402713) has the molecular formula C15H16O4
and a molecular weight of 260.29 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate.
Molecular Properties
| Compound Name | [(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate |
| PubChem CID | 11402713 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | [(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate |
| SMILES | C[C@](CO)(COC(=O)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C15H16O4/c1-15(10-16,12-6-3-2-4-7-12)11-19-14(17)13-8-5-9-18-13/h2-9,16H,10-11H2,1H3/t15-/m0/s1 |
| InChIKey | OCRONQMLWGETFK-HNNXBMFYSA-N |
| XLogP | 2.39 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate?
The IUPAC name of [(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate (CID 11402713) is [(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate.
What is the SMILES notation for [(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate?
The canonical SMILES for [(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate is C[C@](CO)(COC(=O)c1ccco1)c1ccccc1.
What is the InChIKey of [(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate?
The InChIKey is OCRONQMLWGETFK-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H16O4/c1-15(10-16,12-6-3-2-4-7-12)11-19-14(17)13-8-5-9-18-13/h2-9,16H,10-11H2,1H3/t15-/m0/s1.
What are the key properties of [(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate?
[(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate has a molecular weight of 260.29 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-hydroxy-2-methyl-2-phenylpropyl] furan-2-carboxylate is sourced from PubChem (CID 11402713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).